C32H36FN7O3 — CID 58396865
1-[4-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]urea (PubChem CID 58396865) has the molecular formula C32H36FN7O3 and a molecular weight of 585.68 g/mol. Its IUPAC name is 1-[4-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]urea.
| Compound Name | 1-[4-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]urea |
|---|---|
| PubChem CID | 58396865 |
| Molecular Formula | C32H36FN7O3 |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 1-[4-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-[3-fluoro-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]urea |
| SMILES | CCc1nccc(-c2cccnc2Oc2ccc(NC(=O)Nc3ccc(OCCCN4CCN(C)CC4)c(F)c3)cc2)n1 |
| InChI | InChI=1S/C32H36FN7O3/c1-3-30-34-15-13-28(38-30)26-6-4-14-35-31(26)43-25-10-7-23(8-11-25)36-32(41)37-24-9-12-29(27(33)22-24)42-21-5-16-40-19-17-39(2)18-20-40/h4,6-15,22H,3,5,16-21H2,1-2H3,(H2,36,37,41) |
| InChIKey | CXKZEGUZSKWNFJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|