C31H32F3N5O2 — CID 58396417
N-[4-[[3-[2-[5-(dimethylamino)pentyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 58396417) has the molecular formula C31H32F3N5O2 and a molecular weight of 563.62 g/mol. Its IUPAC name is N-[4-[[3-[2-[5-(dimethylamino)pentyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[[3-[2-[5-(dimethylamino)pentyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58396417 |
| Molecular Formula | C31H32F3N5O2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | N-[4-[[3-[2-[5-(dimethylamino)pentyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1Oc1ncccc1-c1ccnc(CCCCCN(C)C)n1 |
| InChI | InChI=1S/C31H32F3N5O2/c1-21-19-24(37-29(40)22-9-7-10-23(20-22)31(32,33)34)13-14-27(21)41-30-25(11-8-16-36-30)26-15-17-35-28(38-26)12-5-4-6-18-39(2)3/h7-11,13-17,19-20H,4-6,12,18H2,1-3H3,(H,37,40) |
| InChIKey | WHEGSLUXKSMYAI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|