C30H30F3N5O2 — CID 58396470
N-[4-[[3-[2-[4-(dimethylamino)butyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 58396470) has the molecular formula C30H30F3N5O2 and a molecular weight of 549.60 g/mol. Its IUPAC name is N-[4-[[3-[2-[4-(dimethylamino)butyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[[3-[2-[4-(dimethylamino)butyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58396470 |
| Molecular Formula | C30H30F3N5O2 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | N-[4-[[3-[2-[4-(dimethylamino)butyl]pyrimidin-4-yl]-2-pyridinyl]oxy]-3-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1Oc1ncccc1-c1ccnc(CCCCN(C)C)n1 |
| InChI | InChI=1S/C30H30F3N5O2/c1-20-18-23(36-28(39)21-8-6-9-22(19-21)30(31,32)33)12-13-26(20)40-29-24(10-7-15-35-29)25-14-16-34-27(37-25)11-4-5-17-38(2)3/h6-10,12-16,18-19H,4-5,11,17H2,1-3H3,(H,36,39) |
| InChIKey | PCPDDNPXYYWRCB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|