C24H16ClF3N4O — CID 58396685
4-chloro-3-[(3-pyrimidin-4-yl-2-pyridinyl)methyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 58396685) has the molecular formula C24H16ClF3N4O and a molecular weight of 468.87 g/mol. Its IUPAC name is 4-chloro-3-[(3-pyrimidin-4-yl-2-pyridinyl)methyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-[(3-pyrimidin-4-yl-2-pyridinyl)methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58396685 |
| Molecular Formula | C24H16ClF3N4O |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-chloro-3-[(3-pyrimidin-4-yl-2-pyridinyl)methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(Cl)c(Cc2ncccc2-c2ccncn2)c1 |
| InChI | InChI=1S/C24H16ClF3N4O/c25-20-7-6-15(23(33)32-18-4-1-3-17(13-18)24(26,27)28)11-16(20)12-22-19(5-2-9-30-22)21-8-10-29-14-31-21/h1-11,13-14H,12H2,(H,32,33) |
| InChIKey | IYJQPOSBQRSAKY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |