C35H42N4O3 — CID 58396829
4-methyl-3-[[3-[2-(4-morpholin-4-ylbutyl)-2,3-dihydropyridin-4-yl]-2-pyridinyl]oxy]-N-(3-propan-2-ylphenyl)benzamide (PubChem CID 58396829) has the molecular formula C35H42N4O3 and a molecular weight of 566.75 g/mol. Its IUPAC name is 4-methyl-3-[[3-[2-(4-morpholin-4-ylbutyl)-2,3-dihydropyridin-4-yl]-2-pyridinyl]oxy]-N-(3-propan-2-ylphenyl)benzamide.
| Compound Name | 4-methyl-3-[[3-[2-(4-morpholin-4-ylbutyl)-2,3-dihydropyridin-4-yl]-2-pyridinyl]oxy]-N-(3-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 58396829 |
| Molecular Formula | C35H42N4O3 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 4-methyl-3-[[3-[2-(4-morpholin-4-ylbutyl)-2,3-dihydropyridin-4-yl]-2-pyridinyl]oxy]-N-(3-propan-2-ylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(C)C)c2)cc1Oc1ncccc1C1=CC=NC(CCCCN2CCOCC2)C1 |
| InChI | InChI=1S/C35H42N4O3/c1-25(2)27-8-6-10-31(22-27)38-34(40)29-13-12-26(3)33(24-29)42-35-32(11-7-15-37-35)28-14-16-36-30(23-28)9-4-5-17-39-18-20-41-21-19-39/h6-8,10-16,22,24-25,30H,4-5,9,17-21,23H2,1-3H3,(H,38,40) |
| InChIKey | MFXORHIKFZLIGQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|