C37H44N6O4 — CID 58397038
N-(5-cyclohexyl-2-methoxyphenyl)-4-methyl-3-[[3-[4-(4-morpholin-4-ylbutyl)-1,3,5-triazin-2-yl]-2-pyridinyl]oxy]benzamide (PubChem CID 58397038) has the molecular formula C37H44N6O4 and a molecular weight of 636.80 g/mol. Its IUPAC name is N-(5-cyclohexyl-2-methoxyphenyl)-4-methyl-3-[[3-[4-(4-morpholin-4-ylbutyl)-1,3,5-triazin-2-yl]-2-pyridinyl]oxy]benzamide.
| Compound Name | N-(5-cyclohexyl-2-methoxyphenyl)-4-methyl-3-[[3-[4-(4-morpholin-4-ylbutyl)-1,3,5-triazin-2-yl]-2-pyridinyl]oxy]benzamide |
|---|---|
| PubChem CID | 58397038 |
| Molecular Formula | C37H44N6O4 |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | N-(5-cyclohexyl-2-methoxyphenyl)-4-methyl-3-[[3-[4-(4-morpholin-4-ylbutyl)-1,3,5-triazin-2-yl]-2-pyridinyl]oxy]benzamide |
| SMILES | COc1ccc(C2CCCCC2)cc1NC(=O)c1ccc(C)c(Oc2ncccc2-c2ncnc(CCCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C37H44N6O4/c1-26-13-14-29(36(44)41-31-23-28(15-16-32(31)45-2)27-9-4-3-5-10-27)24-33(26)47-37-30(11-8-17-38-37)35-40-25-39-34(42-35)12-6-7-18-43-19-21-46-22-20-43/h8,11,13-17,23-25,27H,3-7,9-10,12,18-22H2,1-2H3,(H,41,44) |
| InChIKey | QJAHHKWRIYKOPV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|