C23H19F7N4O2 — CID 58397297
3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-methylbenzamide (PubChem CID 58397297) has the molecular formula C23H19F7N4O2 and a molecular weight of 516.42 g/mol. Its IUPAC name is 3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-methylbenzamide.
| Compound Name | 3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 58397297 |
| Molecular Formula | C23H19F7N4O2 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-methylbenzamide |
| SMILES | CCc1nccc(-c2cccnc2Oc2cc(C(=O)NCC(F)(F)C(F)(F)C(F)(F)F)ccc2C)n1 |
| InChI | InChI=1S/C23H19F7N4O2/c1-3-18-31-10-8-16(34-18)15-5-4-9-32-20(15)36-17-11-14(7-6-13(17)2)19(35)33-12-21(24,25)22(26,27)23(28,29)30/h4-11H,3,12H2,1-2H3,(H,33,35) |
| InChIKey | AFCUYQKYHLZRMU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|