C24H25F3N4O3S — CID 58397391
4-butoxy-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one (PubChem CID 58397391) has the molecular formula C24H25F3N4O3S and a molecular weight of 506.55 g/mol. Its IUPAC name is 4-butoxy-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one.
| Compound Name | 4-butoxy-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 58397391 |
| Molecular Formula | C24H25F3N4O3S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 4-butoxy-1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
| SMILES | CCCCOCCCC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C |
| InChI | InChI=1S/C24H25F3N4O3S/c1-3-4-11-33-12-5-6-20(32)15-7-10-19-18(13-15)28-22(31(19)2)30-23-29-17-9-8-16(14-21(17)35-23)34-24(25,26)27/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,28,29,30) |
| InChIKey | VSOFCIPIAFCMAC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|