C25H26F3N5O3S — CID 58397412
1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-5-morpholin-4-ylpentan-1-one (PubChem CID 58397412) has the molecular formula C25H26F3N5O3S and a molecular weight of 533.58 g/mol. Its IUPAC name is 1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-5-morpholin-4-ylpentan-1-one.
| Compound Name | 1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-5-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 58397412 |
| Molecular Formula | C25H26F3N5O3S |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 1-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-5-morpholin-4-ylpentan-1-one |
| SMILES | Cn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)CCCCN3CCOCC3)ccc21 |
| InChI | InChI=1S/C25H26F3N5O3S/c1-32-20-8-5-16(21(34)4-2-3-9-33-10-12-35-13-11-33)14-19(20)29-23(32)31-24-30-18-7-6-17(15-22(18)37-24)36-25(26,27)28/h5-8,14-15H,2-4,9-13H2,1H3,(H,29,30,31) |
| InChIKey | LGFVRQNOGCVSDU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|