C21H20F2N4O2S — CID 58397461
1-[2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-ethoxybutan-1-one (PubChem CID 58397461) has the molecular formula C21H20F2N4O2S and a molecular weight of 430.48 g/mol. Its IUPAC name is 1-[2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-ethoxybutan-1-one.
| Compound Name | 1-[2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-ethoxybutan-1-one |
|---|---|
| PubChem CID | 58397461 |
| Molecular Formula | C21H20F2N4O2S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[2-[(5,6-difluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-ethoxybutan-1-one |
| SMILES | CCOCCCC(=O)c1ccc2c(c1)nc(Nc1nc3cc(F)c(F)cc3s1)n2C |
| InChI | InChI=1S/C21H20F2N4O2S/c1-3-29-8-4-5-18(28)12-6-7-17-15(9-12)24-20(27(17)2)26-21-25-16-10-13(22)14(23)11-19(16)30-21/h6-7,9-11H,3-5,8H2,1-2H3,(H,24,25,26) |
| InChIKey | UWUGKIRDBCJTDX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|