C25H25F3N4O4S — CID 58397380
5-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutoxy]pentan-2-one (PubChem CID 58397380) has the molecular formula C25H25F3N4O4S and a molecular weight of 534.56 g/mol. Its IUPAC name is 5-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutoxy]pentan-2-one.
| Compound Name | 5-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutoxy]pentan-2-one |
|---|---|
| PubChem CID | 58397380 |
| Molecular Formula | C25H25F3N4O4S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 5-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutoxy]pentan-2-one |
| SMILES | CC(=O)CCCOCCCC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C |
| InChI | InChI=1S/C25H25F3N4O4S/c1-15(33)5-3-11-35-12-4-6-21(34)16-7-10-20-19(13-16)29-23(32(20)2)31-24-30-18-9-8-17(14-22(18)37-24)36-25(26,27)28/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,29,30,31) |
| InChIKey | GEHXAZJVJIQTEU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|