C23H23F3N4O2S — CID 58397503
4-ethoxy-1-[1-ethyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one (PubChem CID 58397503) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is 4-ethoxy-1-[1-ethyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one.
| Compound Name | 4-ethoxy-1-[1-ethyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 58397503 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-ethoxy-1-[1-ethyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]butan-1-one |
| SMILES | CCOCCCC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(C(F)(F)F)cc3s1)n2CC |
| InChI | InChI=1S/C23H23F3N4O2S/c1-3-30-18-10-7-14(19(31)6-5-11-32-4-2)12-17(18)27-21(30)29-22-28-16-9-8-15(23(24,25)26)13-20(16)33-22/h7-10,12-13H,3-6,11H2,1-2H3,(H,27,28,29) |
| InChIKey | XMXZJIPNQKRPLB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|