About methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate
methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate (PubChem CID 58397644) has the molecular formula C17H13FN4O2S
and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate |
| PubChem CID | 58397644 |
| Molecular Formula | C17H13FN4O2S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(F)cc3s1)n2C |
| InChI | InChI=1S/C17H13FN4O2S/c1-22-13-6-3-9(15(23)24-2)7-12(13)19-16(22)21-17-20-11-5-4-10(18)8-14(11)25-17/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | QTHLPENJSBEZOQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate?
The IUPAC name of methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate (CID 58397644) is methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate.
What is the SMILES notation for methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate?
The canonical SMILES for methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate is COC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(F)cc3s1)n2C.
What is the InChIKey of methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate?
The InChIKey is QTHLPENJSBEZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN4O2S/c1-22-13-6-3-9(15(23)24-2)7-12(13)19-16(22)21-17-20-11-5-4-10(18)8-14(11)25-17/h3-8H,1-2H3,(H,19,20,21).
What are the key properties of methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate?
methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate has a molecular weight of 356.38 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazole-5-carboxylate is sourced from PubChem (CID 58397644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).