C25H26F6N6O — CID 58398034
8-[3,5-bis(trifluoromethyl)phenyl]-N-[1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 58398034) has the molecular formula C25H26F6N6O and a molecular weight of 540.51 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenyl]-N-[1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenyl]-N-[1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 58398034 |
| Molecular Formula | C25H26F6N6O |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenyl]-N-[1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1cc(N2CCC(Nc3nc4n(n3)CCCC4c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)ccn1 |
| InChI | InChI=1S/C25H26F6N6O/c1-38-21-14-19(4-7-32-21)36-9-5-18(6-10-36)33-23-34-22-20(3-2-8-37(22)35-23)15-11-16(24(26,27)28)13-17(12-15)25(29,30)31/h4,7,11-14,18,20H,2-3,5-6,8-10H2,1H3,(H,33,35) |
| InChIKey | WDLGOQQGBJQFDJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |