C24H25F3N6O2 — CID 162471325
N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine (PubChem CID 162471325) has the molecular formula C24H25F3N6O2 and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine.
| Compound Name | N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 162471325 |
| Molecular Formula | C24H25F3N6O2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine |
| SMILES | COc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3n(n2)CCOC3c2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C24H25F3N6O2/c1-34-18-10-15(6-7-28-18)32-11-13-2-3-14(12-32)21(13)29-24-30-23-22(35-9-8-33(23)31-24)16-4-5-17(25)20(27)19(16)26/h4-7,10,13-14,21-22H,2-3,8-9,11-12H2,1H3,(H,29,31)/t13-,14+,21?,22? |
| InChIKey | QPNQIWQBOLYFRT-NAZSJPOASA-N |
| XLogP | 3.55 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|