C24H27F3N6O2 — CID 170309351
(8R)-N-[(1S,5R)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine (PubChem CID 170309351) has the molecular formula C24H27F3N6O2 and a molecular weight of 488.51 g/mol. Its IUPAC name is (8R)-N-[(1S,5R)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine.
| Compound Name | (8R)-N-[(1S,5R)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 170309351 |
| Molecular Formula | C24H27F3N6O2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (8R)-N-[(1S,5R)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine |
| SMILES | COc1cc(N2C[C@H]3CC[C@@H](C2)C3NC2=NC3[C@@H](c4ccc(F)c(F)c4F)OCCN3N2)ccn1 |
| InChI | InChI=1S/C24H27F3N6O2/c1-34-18-10-15(6-7-28-18)32-11-13-2-3-14(12-32)21(13)29-24-30-23-22(35-9-8-33(23)31-24)16-4-5-17(25)20(27)19(16)26/h4-7,10,13-14,21-23H,2-3,8-9,11-12H2,1H3,(H2,29,30,31)/t13-,14+,21?,22-,23?/m1/s1 |
| InChIKey | STEBYEXAFBQDPT-HFUSOICVSA-N |
| XLogP | 2.59 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|