C23H26F3N7O2 — CID 170309391
(8R)-N-[(1S,5R)-3-(6-methoxypyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine (PubChem CID 170309391) has the molecular formula C23H26F3N7O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is (8R)-N-[(1S,5R)-3-(6-methoxypyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine.
| Compound Name | (8R)-N-[(1S,5R)-3-(6-methoxypyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 170309391 |
| Molecular Formula | C23H26F3N7O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (8R)-N-[(1S,5R)-3-(6-methoxypyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenyl)-5,6,8,8a-tetrahydro-3H-[1,2,4]triazolo[5,1-c][1,4]oxazin-2-amine |
| SMILES | COc1cc(N2C[C@H]3CC[C@@H](C2)C3NC2=NC3[C@@H](c4ccc(F)c(F)c4F)OCCN3N2)cnn1 |
| InChI | InChI=1S/C23H26F3N7O2/c1-34-17-8-14(9-27-30-17)32-10-12-2-3-13(11-32)20(12)28-23-29-22-21(35-7-6-33(22)31-23)15-4-5-16(24)19(26)18(15)25/h4-5,8-9,12-13,20-22H,2-3,6-7,10-11H2,1H3,(H2,28,29,31)/t12-,13+,20?,21-,22?/m1/s1 |
| InChIKey | DLYQIMRXYHWRIT-GFJQABJLSA-N |
| XLogP | 1.98 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|