C24H26F3N7O — CID 162784601
(8S)-N-[(1S,5R)-3-(6-methylpyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 162784601) has the molecular formula C24H26F3N7O and a molecular weight of 485.51 g/mol. Its IUPAC name is (8S)-N-[(1S,5R)-3-(6-methylpyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | (8S)-N-[(1S,5R)-3-(6-methylpyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 162784601 |
| Molecular Formula | C24H26F3N7O |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (8S)-N-[(1S,5R)-3-(6-methylpyridazin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,3,4-trifluorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3n(n2)CCC[C@@H]3Oc2ccc(F)c(F)c2F)cnn1 |
| InChI | InChI=1S/C24H26F3N7O/c1-13-9-16(10-28-31-13)33-11-14-4-5-15(12-33)22(14)29-24-30-23-19(3-2-8-34(23)32-24)35-18-7-6-17(25)20(26)21(18)27/h6-7,9-10,14-15,19,22H,2-5,8,11-12H2,1H3,(H,29,32)/t14-,15+,19-,22?/m0/s1 |
| InChIKey | CJCYKKFCAIEBPU-BQXYONTDSA-N |
| XLogP | 4.03 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|