C22H23F3N8 — CID 166878679
N-[(5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine (PubChem CID 166878679) has the molecular formula C22H23F3N8 and a molecular weight of 456.48 g/mol. Its IUPAC name is N-[(5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine.
| Compound Name | N-[(5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine |
|---|---|
| PubChem CID | 166878679 |
| Molecular Formula | C22H23F3N8 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[(5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine |
| SMILES | Cc1cc(N2CC3CC[C@@H](C2)C3Nc2nc3n(n2)CCN3c2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C22H23F3N8/c1-12-8-17(27-11-26-12)31-9-13-2-3-14(10-31)20(13)28-21-29-22-32(6-7-33(22)30-21)16-5-4-15(23)18(24)19(16)25/h4-5,8,11,13-14,20H,2-3,6-7,9-10H2,1H3,(H,28,30)/t13-,14?,20?/m0/s1 |
| InChIKey | XOLVVJOCZKOIAY-LTQQYIGLSA-N |
| XLogP | 3.27 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|