C23H25F3N8 — CID 146306619
N-[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-[4-(trifluoromethyl)phenyl]-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine (PubChem CID 146306619) has the molecular formula C23H25F3N8 and a molecular weight of 470.50 g/mol. Its IUPAC name is N-[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-[4-(trifluoromethyl)phenyl]-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine.
| Compound Name | N-[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-[4-(trifluoromethyl)phenyl]-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine |
|---|---|
| PubChem CID | 146306619 |
| Molecular Formula | C23H25F3N8 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-4-[4-(trifluoromethyl)phenyl]-5,6-dihydroimidazo[1,2-b][1,2,4]triazol-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3n(n2)CCN3c2ccc(C(F)(F)F)cc2)ncn1 |
| InChI | InChI=1S/C23H25F3N8/c1-14-10-19(28-13-27-14)32-11-15-2-3-16(12-32)20(15)29-21-30-22-33(8-9-34(22)31-21)18-6-4-17(5-7-18)23(24,25)26/h4-7,10,13,15-16,20H,2-3,8-9,11-12H2,1H3,(H,29,31)/t15-,16+,20? |
| InChIKey | ZARAJXPSYXIZAY-NYTJIUQPSA-N |
| XLogP | 3.87 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |