C21H22F5N7O — CID 137379538
N-[3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 137379538) has the molecular formula C21H22F5N7O and a molecular weight of 483.45 g/mol. Its IUPAC name is N-[3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 137379538 |
| Molecular Formula | C21H22F5N7O |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2CC3CCC(C2)C3Nc2nc3c(OCC(F)(F)C(F)(F)F)cccn3n2)ncn1 |
| InChI | InChI=1S/C21H22F5N7O/c1-12-7-16(28-11-27-12)32-8-13-4-5-14(9-32)17(13)29-19-30-18-15(3-2-6-33(18)31-19)34-10-20(22,23)21(24,25)26/h2-3,6-7,11,13-14,17H,4-5,8-10H2,1H3,(H,29,31) |
| InChIKey | FFVNIDSLGBUZBP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|