C19H20F5N7OS — CID 129216730
N-[(1R,5S)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 129216730) has the molecular formula C19H20F5N7OS and a molecular weight of 489.47 g/mol. Its IUPAC name is N-[(1R,5S)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | N-[(1R,5S)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 129216730 |
| Molecular Formula | C19H20F5N7OS |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[(1R,5S)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(OCC(F)(F)C(F)(F)F)nccn3n2)sn1 |
| InChI | InChI=1S/C19H20F5N7OS/c1-10-6-13(33-29-10)30-7-11-2-3-12(8-30)14(11)26-17-27-15-16(25-4-5-31(15)28-17)32-9-18(20,21)19(22,23)24/h4-6,11-12,14H,2-3,7-9H2,1H3,(H,26,28)/t11-,12+,14? |
| InChIKey | ZXHPEVSEBDNMIS-ONXXMXGDSA-N |
| XLogP | 3.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|