C20H22F3N5OS — CID 158193474
3-methyl-5-[(1S,5R)-8-[[5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole (PubChem CID 158193474) has the molecular formula C20H22F3N5OS and a molecular weight of 437.49 g/mol. Its IUPAC name is 3-methyl-5-[(1S,5R)-8-[[5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole.
| Compound Name | 3-methyl-5-[(1S,5R)-8-[[5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole |
|---|---|
| PubChem CID | 158193474 |
| Molecular Formula | C20H22F3N5OS |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-methyl-5-[(1S,5R)-8-[[5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3cccc(OCC(F)(F)F)n3n2)sn1 |
| InChI | InChI=1S/C20H22F3N5OS/c1-12-7-19(30-26-12)27-9-13-5-6-14(10-27)15(13)8-16-24-17-3-2-4-18(28(17)25-16)29-11-20(21,22)23/h2-4,7,13-15H,5-6,8-11H2,1H3/t13-,14+,15? |
| InChIKey | GAAZDGOKFVYCMA-YIONKMFJSA-N |
| XLogP | 4.14 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |