C25H23F4N5S — CID 158176852
5-[(1R,5S)-8-[[8-[5-fluoro-2-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-3-methyl-1,2-thiazole (PubChem CID 158176852) has the molecular formula C25H23F4N5S and a molecular weight of 501.55 g/mol. Its IUPAC name is 5-[(1R,5S)-8-[[8-[5-fluoro-2-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-3-methyl-1,2-thiazole.
| Compound Name | 5-[(1R,5S)-8-[[8-[5-fluoro-2-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-3-methyl-1,2-thiazole |
|---|---|
| PubChem CID | 158176852 |
| Molecular Formula | C25H23F4N5S |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 5-[(1R,5S)-8-[[8-[5-fluoro-2-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-3-methyl-1,2-thiazole |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3c(-c4cc(F)ccc4C(F)(F)F)cccn3n2)sn1 |
| InChI | InChI=1S/C25H23F4N5S/c1-14-9-23(35-32-14)33-12-15-4-5-16(13-33)19(15)11-22-30-24-18(3-2-8-34(24)31-22)20-10-17(26)6-7-21(20)25(27,28)29/h2-3,6-10,15-16,19H,4-5,11-13H2,1H3/t15-,16+,19? |
| InChIKey | FYCJUMPEPLYHON-MCPYQZEQSA-N |
| XLogP | 6.02 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |