C26H26F3N5OS — CID 147113840
3-methyl-5-[(1R,5S)-8-[[8-[4-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole (PubChem CID 147113840) has the molecular formula C26H26F3N5OS and a molecular weight of 513.59 g/mol. Its IUPAC name is 3-methyl-5-[(1R,5S)-8-[[8-[4-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole.
| Compound Name | 3-methyl-5-[(1R,5S)-8-[[8-[4-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole |
|---|---|
| PubChem CID | 147113840 |
| Molecular Formula | C26H26F3N5OS |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 3-methyl-5-[(1R,5S)-8-[[8-[4-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]methyl]-3-azabicyclo[3.2.1]octan-3-yl]-1,2-thiazole |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3c(-c4ccc(OCC(F)(F)F)cc4)cccn3n2)sn1 |
| InChI | InChI=1S/C26H26F3N5OS/c1-16-11-24(36-32-16)33-13-18-4-5-19(14-33)22(18)12-23-30-25-21(3-2-10-34(25)31-23)17-6-8-20(9-7-17)35-15-26(27,28)29/h2-3,6-11,18-19,22H,4-5,12-15H2,1H3/t18-,19+,22? |
| InChIKey | BNAGPJLZBZLCET-QIDMFYOTSA-N |
| XLogP | 5.81 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |