C18H19F3N6OS — CID 146383618
N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(trifluoromethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 146383618) has the molecular formula C18H19F3N6OS and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(trifluoromethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(trifluoromethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 146383618 |
| Molecular Formula | C18H19F3N6OS |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(trifluoromethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(OC(F)(F)F)cccn3n2)sn1 |
| InChI | InChI=1S/C18H19F3N6OS/c1-10-7-14(29-25-10)26-8-11-4-5-12(9-26)15(11)22-17-23-16-13(28-18(19,20)21)3-2-6-27(16)24-17/h2-3,6-7,11-12,15H,4-5,8-9H2,1H3,(H,22,24)/t11-,12+,15? |
| InChIKey | PQVUTAMWZOPJRQ-ODOQXGPZSA-N |
| XLogP | 3.72 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |