C20H23F3N6OS — CID 129232862
N-[3-methyl-5-methylidene-1-(3-methyl-1,2-thiazol-5-yl)piperidin-4-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232862) has the molecular formula C20H23F3N6OS and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[3-methyl-5-methylidene-1-(3-methyl-1,2-thiazol-5-yl)piperidin-4-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-methyl-5-methylidene-1-(3-methyl-1,2-thiazol-5-yl)piperidin-4-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232862 |
| Molecular Formula | C20H23F3N6OS |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[3-methyl-5-methylidene-1-(3-methyl-1,2-thiazol-5-yl)piperidin-4-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C=C1CN(c2cc(C)ns2)CC(C)C1Nc1nc2c(OC(C)C(F)(F)F)cccn2n1 |
| InChI | InChI=1S/C20H23F3N6OS/c1-11-9-28(16-8-13(3)27-31-16)10-12(2)17(11)24-19-25-18-15(6-5-7-29(18)26-19)30-14(4)20(21,22)23/h5-8,12,14,17H,1,9-10H2,2-4H3,(H,24,26) |
| InChIKey | DDGQCDOTBDDYKI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|