C20H24F3N7OS — CID 129216713
N-[3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129216713) has the molecular formula C20H24F3N7OS and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129216713 |
| Molecular Formula | C20H24F3N7OS |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-[3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2CC3CCC(C2)C3Nc2nc3c(OCCCC(F)(F)F)cccn3n2)n1 |
| InChI | InChI=1S/C20H24F3N7OS/c1-12-24-19(32-28-12)29-10-13-5-6-14(11-29)16(13)25-18-26-17-15(4-2-8-30(17)27-18)31-9-3-7-20(21,22)23/h2,4,8,13-14,16H,3,5-7,9-11H2,1H3,(H,25,27) |
| InChIKey | ONBGPUYSPIJKCI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|