C20H20F4N6O — CID 129232179
N-[(1S,5R)-3-(3-fluoro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232179) has the molecular formula C20H20F4N6O and a molecular weight of 436.41 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-fluoro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-fluoro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232179 |
| Molecular Formula | C20H20F4N6O |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[(1S,5R)-3-(3-fluoro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Fc1cnccc1N1C[C@H]2CC[C@@H](C1)C2Nc1nc2c(OCC(F)(F)F)cccn2n1 |
| InChI | InChI=1S/C20H20F4N6O/c21-14-8-25-6-5-15(14)29-9-12-3-4-13(10-29)17(12)26-19-27-18-16(31-11-20(22,23)24)2-1-7-30(18)28-19/h1-2,5-8,12-13,17H,3-4,9-11H2,(H,26,28)/t12-,13+,17? |
| InChIKey | ODPRYBOIWFYFOG-MPYYAJLASA-N |
| XLogP | 3.53 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |