C22H20F8N6O — CID 129216702
8-(2,2,3,3,3-pentafluoropropoxy)-N-[3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129216702) has the molecular formula C22H20F8N6O and a molecular weight of 536.43 g/mol. Its IUPAC name is 8-(2,2,3,3,3-pentafluoropropoxy)-N-[3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(2,2,3,3,3-pentafluoropropoxy)-N-[3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129216702 |
| Molecular Formula | C22H20F8N6O |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 8-(2,2,3,3,3-pentafluoropropoxy)-N-[3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(N2CC3CCC(C2)C3Nc2nc3c(OCC(F)(F)C(F)(F)F)cccn3n2)ccn1 |
| InChI | InChI=1S/C22H20F8N6O/c23-20(24,22(28,29)30)11-37-15-2-1-7-36-18(15)33-19(34-36)32-17-12-3-4-13(17)10-35(9-12)14-5-6-31-16(8-14)21(25,26)27/h1-2,5-8,12-13,17H,3-4,9-11H2,(H,32,34) |
| InChIKey | IPTUPSATVHFIAU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|