C21H20ClF5N6O — CID 129232570
N-[(1S,5R)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232570) has the molecular formula C21H20ClF5N6O and a molecular weight of 502.88 g/mol. Its IUPAC name is N-[(1S,5R)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232570 |
| Molecular Formula | C21H20ClF5N6O |
| Molecular Weight | 502.88 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[(1S,5R)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | FC(F)COc1ccc(C(F)(F)F)n2nc(NC3[C@@H]4CC[C@H]3CN(c3ccnc(Cl)c3)C4)nc12 |
| InChI | InChI=1S/C21H20ClF5N6O/c22-16-7-13(5-6-28-16)32-8-11-1-2-12(9-32)18(11)29-20-30-19-14(34-10-17(23)24)3-4-15(21(25,26)27)33(19)31-20/h3-7,11-12,17-18H,1-2,8-10H2,(H,29,31)/t11-,12+,18? |
| InChIKey | XXOUOMMNHNMWNZ-HWRGOXINSA-N |
| XLogP | 4.77 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|