C23H24ClF2N7 — CID 146306631
N-[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 146306631) has the molecular formula C23H24ClF2N7 and a molecular weight of 471.94 g/mol. Its IUPAC name is N-[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | N-[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 146306631 |
| Molecular Formula | C23H24ClF2N7 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Fc1ccc(N2CCCn3nc(NC4[C@@H]5CC[C@H]4CN(c4ccnc(Cl)c4)C5)nc32)cc1F |
| InChI | InChI=1S/C23H24ClF2N7/c24-20-11-16(6-7-27-20)31-12-14-2-3-15(13-31)21(14)28-22-29-23-32(8-1-9-33(23)30-22)17-4-5-18(25)19(26)10-17/h4-7,10-11,14-15,21H,1-3,8-9,12-13H2,(H,28,30)/t14-,15+,21? |
| InChIKey | GKMMOHAZHITCIJ-YLQYIJTPSA-N |
| XLogP | 4.47 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|