C23H24ClF2N7 — CID 158335669
2-[[(1S,5R)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 158335669) has the molecular formula C23H24ClF2N7 and a molecular weight of 471.94 g/mol. Its IUPAC name is 2-[[(1S,5R)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[[(1S,5R)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 158335669 |
| Molecular Formula | C23H24ClF2N7 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[[(1S,5R)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Fc1ccc(N2CCCn3nc(CC4[C@@H]5CC[C@H]4CN(c4cc(Cl)ncn4)C5)nc32)cc1F |
| InChI | InChI=1S/C23H24ClF2N7/c24-20-10-22(28-13-27-20)31-11-14-2-3-15(12-31)17(14)9-21-29-23-32(6-1-7-33(23)30-21)16-4-5-18(25)19(26)8-16/h4-5,8,10,13-15,17H,1-3,6-7,9,11-12H2/t14-,15+,17? |
| InChIKey | GQNXGYBRYBYYEL-FKEKPDDDSA-N |
| XLogP | 4.25 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |