C25H27F3N6O — CID 158371561
(9S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepine (PubChem CID 158371561) has the molecular formula C25H27F3N6O and a molecular weight of 484.53 g/mol. Its IUPAC name is (9S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepine.
| Compound Name | (9S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepine |
|---|---|
| PubChem CID | 158371561 |
| Molecular Formula | C25H27F3N6O |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (9S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-c][1,4]oxazepine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3n(n2)CCCO[C@H]3c2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C25H27F3N6O/c1-14-9-21(30-13-29-14)33-11-15-3-4-16(12-33)18(15)10-20-31-25-24(35-8-2-7-34(25)32-20)17-5-6-19(26)23(28)22(17)27/h5-6,9,13,15-16,18,24H,2-4,7-8,10-12H2,1H3/t15-,16+,18?,24-/m0/s1 |
| InChIKey | DPSCBVFPGVPZDB-LURLYOAGSA-N |
| XLogP | 4.01 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|