C25H26ClF3N6 — CID 159347322
(9R)-2-[[(1R,5S)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine (PubChem CID 159347322) has the molecular formula C25H26ClF3N6 and a molecular weight of 502.97 g/mol. Its IUPAC name is (9R)-2-[[(1R,5S)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine.
| Compound Name | (9R)-2-[[(1R,5S)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine |
|---|---|
| PubChem CID | 159347322 |
| Molecular Formula | C25H26ClF3N6 |
| Molecular Weight | 502.97 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (9R)-2-[[(1R,5S)-3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-9-(2,3,4-trifluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine |
| SMILES | Fc1ccc([C@H]2CCCCn3nc(CC4[C@@H]5CC[C@H]4CN(c4cc(Cl)ncn4)C5)nc32)c(F)c1F |
| InChI | InChI=1S/C25H26ClF3N6/c26-20-10-22(31-13-30-20)34-11-14-4-5-15(12-34)18(14)9-21-32-25-17(3-1-2-8-35(25)33-21)16-6-7-19(27)24(29)23(16)28/h6-7,10,13-15,17-18H,1-5,8-9,11-12H2/t14-,15+,17-,18?/m1/s1 |
| InChIKey | GTPLLPZHOHFLAL-FZBAJKBMSA-N |
| XLogP | 5.16 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.97 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|