C23H24F3N7 — CID 159007159
2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazole (PubChem CID 159007159) has the molecular formula C23H24F3N7 and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazole.
| Compound Name | 2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 159007159 |
| Molecular Formula | C23H24F3N7 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-4-(2,3,4-trifluorophenyl)-5,6-dihydroimidazo[1,2-b][1,2,4]triazole |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3n(n2)CCN3c2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C23H24F3N7/c1-13-8-20(28-12-27-13)31-10-14-2-3-15(11-31)16(14)9-19-29-23-32(6-7-33(23)30-19)18-5-4-17(24)21(25)22(18)26/h4-5,8,12,14-16H,2-3,6-7,9-11H2,1H3/t14-,15+,16? |
| InChIKey | JSBIUZUUQRJXHY-XYPWUTKMSA-N |
| XLogP | 3.65 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|