C24H25F3N6O — CID 160596317
(8S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine (PubChem CID 160596317) has the molecular formula C24H25F3N6O and a molecular weight of 470.50 g/mol. Its IUPAC name is (8S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine.
| Compound Name | (8S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 160596317 |
| Molecular Formula | C24H25F3N6O |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (8S)-2-[[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,3,4-trifluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Cc2nc3n(n2)CCO[C@H]3c2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C24H25F3N6O/c1-13-8-20(29-12-28-13)32-10-14-2-3-15(11-32)17(14)9-19-30-24-23(34-7-6-33(24)31-19)16-4-5-18(25)22(27)21(16)26/h4-5,8,12,14-15,17,23H,2-3,6-7,9-11H2,1H3/t14-,15+,17?,23-/m0/s1 |
| InChIKey | FSYXWZVWSCDOEC-QDIBZTPLSA-N |
| XLogP | 3.62 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|