C23H26ClF3N6O — CID 138693942
N-[3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 138693942) has the molecular formula C23H26ClF3N6O and a molecular weight of 494.95 g/mol. Its IUPAC name is N-[3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 138693942 |
| Molecular Formula | C23H26ClF3N6O |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC(C)c1ccc(OCC(F)(F)F)n2nc(NC3C4CCC3CN(c3ccnc(Cl)c3)C4)nc12 |
| InChI | InChI=1S/C23H26ClF3N6O/c1-13(2)17-5-6-19(34-12-23(25,26)27)33-21(17)30-22(31-33)29-20-14-3-4-15(20)11-32(10-14)16-7-8-28-18(24)9-16/h5-9,13-15,20H,3-4,10-12H2,1-2H3,(H,29,31) |
| InChIKey | VZMLEWUCMDOBGV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|