C22H24F6N8O — CID 162607048
(1S,5S,8S)-8-N'-[8-methyl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane-1,8,8-triamine (PubChem CID 162607048) has the molecular formula C22H24F6N8O and a molecular weight of 530.48 g/mol. Its IUPAC name is (1S,5S,8S)-8-N'-[8-methyl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane-1,8,8-triamine.
| Compound Name | (1S,5S,8S)-8-N'-[8-methyl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane-1,8,8-triamine |
|---|---|
| PubChem CID | 162607048 |
| Molecular Formula | C22H24F6N8O |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (1S,5S,8S)-8-N'-[8-methyl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane-1,8,8-triamine |
| SMILES | Cc1ccc(OCC(F)(F)F)n2nc(N[C@@]3(N)[C@H]4CC[C@]3(N)CN(c3ccnc(C(F)(F)F)c3)C4)nc12 |
| InChI | InChI=1S/C22H24F6N8O/c1-12-2-3-16(37-11-20(23,24)25)36-17(12)32-18(34-36)33-21(30)13-4-6-19(21,29)10-35(9-13)14-5-7-31-15(8-14)22(26,27)28/h2-3,5,7-8,13H,4,6,9-11,29-30H2,1H3,(H,33,34)/t13-,19-,21-/m0/s1 |
| InChIKey | DQPQEAXUCKJCSB-LPLGYCIKSA-N |
| XLogP | 3.09 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|