C14H17F3N4S — CID 148682305
[(5S)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]thiourea (PubChem CID 148682305) has the molecular formula C14H17F3N4S and a molecular weight of 330.38 g/mol. Its IUPAC name is [(5S)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]thiourea.
| Compound Name | [(5S)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]thiourea |
|---|---|
| PubChem CID | 148682305 |
| Molecular Formula | C14H17F3N4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(5S)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]thiourea |
| SMILES | NC(=S)NC1C2CC[C@H]1CN(c1ccnc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C14H17F3N4S/c15-14(16,17)11-5-10(3-4-19-11)21-6-8-1-2-9(7-21)12(8)20-13(18)22/h3-5,8-9,12H,1-2,6-7H2,(H3,18,20,22)/t8-,9?,12?/m0/s1 |
| InChIKey | NRVWSFRQGLPPNI-QTZUAFFRSA-N |
| XLogP | 2.15 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|