C12H12F3N3 — CID 134515763
3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.1.1]hept-1(7)-en-6-amine (PubChem CID 134515763) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.1.1]hept-1(7)-en-6-amine.
| Compound Name | 3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.1.1]hept-1(7)-en-6-amine |
|---|---|
| PubChem CID | 134515763 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.1.1]hept-1(7)-en-6-amine |
| SMILES | NC1C2=CC1CN(c1ccnc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C12H12F3N3/c13-12(14,15)10-4-9(1-2-17-10)18-5-7-3-8(6-18)11(7)16/h1-4,7,11H,5-6,16H2 |
| InChIKey | QCASLSDFBZKOCK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|