C14H14F3N3S — CID 162607914
(5S)-8-isothiocyanato-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane (PubChem CID 162607914) has the molecular formula C14H14F3N3S and a molecular weight of 313.35 g/mol. Its IUPAC name is (5S)-8-isothiocyanato-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane.
| Compound Name | (5S)-8-isothiocyanato-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 162607914 |
| Molecular Formula | C14H14F3N3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (5S)-8-isothiocyanato-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octane |
| SMILES | FC(F)(F)c1cc(N2CC3CC[C@@H](C2)C3N=C=S)ccn1 |
| InChI | InChI=1S/C14H14F3N3S/c15-14(16,17)12-5-11(3-4-18-12)20-6-9-1-2-10(7-20)13(9)19-8-21/h3-5,9-10,13H,1-2,6-7H2/t9-,10?,13?/m0/s1 |
| InChIKey | SQRLSNAQEPFCSA-JBLZRFIASA-N |
| XLogP | 3.42 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|