C15H17F3N4S — CID 162607910
methyl N'-[(4R)-7-[2-(trifluoromethyl)-4-pyridinyl]-7-azatricyclo[3.3.0.01,3]octan-4-yl]carbamimidothioate (PubChem CID 162607910) has the molecular formula C15H17F3N4S and a molecular weight of 342.39 g/mol. Its IUPAC name is methyl N'-[(4R)-7-[2-(trifluoromethyl)-4-pyridinyl]-7-azatricyclo[3.3.0.01,3]octan-4-yl]carbamimidothioate.
| Compound Name | methyl N'-[(4R)-7-[2-(trifluoromethyl)-4-pyridinyl]-7-azatricyclo[3.3.0.01,3]octan-4-yl]carbamimidothioate |
|---|---|
| PubChem CID | 162607910 |
| Molecular Formula | C15H17F3N4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | methyl N'-[(4R)-7-[2-(trifluoromethyl)-4-pyridinyl]-7-azatricyclo[3.3.0.01,3]octan-4-yl]carbamimidothioate |
| SMILES | CS/C(N)=N\[C@H]1C2CN(c3ccnc(C(F)(F)F)c3)CC23CC13 |
| InChI | InChI=1S/C15H17F3N4S/c1-23-13(19)21-12-9-5-14(9)7-22(6-10(12)14)8-2-3-20-11(4-8)15(16,17)18/h2-4,9-10,12H,5-7H2,1H3,(H2,19,21)/t9?,10?,12-,14?/m1/s1 |
| InChIKey | VKBWTLFBGAXDNQ-FCYNSUMHSA-N |
| XLogP | 2.60 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|