C22H21ClF5N5O — CID 158655854
2-[[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 158655854) has the molecular formula C22H21ClF5N5O and a molecular weight of 501.89 g/mol. Its IUPAC name is 2-[[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 158655854 |
| Molecular Formula | C22H21ClF5N5O |
| Molecular Weight | 501.89 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[[(1R,5S)-3-(2-chloro-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]methyl]-8-(2,2-difluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | FC(F)COc1ccc(C(F)(F)F)n2nc(CC3[C@@H]4CC[C@H]3CN(c3ccnc(Cl)c3)C4)nc12 |
| InChI | InChI=1S/C22H21ClF5N5O/c23-18-7-14(5-6-29-18)32-9-12-1-2-13(10-32)15(12)8-20-30-21-16(34-11-19(24)25)3-4-17(22(26,27)28)33(21)31-20/h3-7,12-13,15,19H,1-2,8-11H2/t12-,13+,15? |
| InChIKey | ICCYXJUHMDIXKF-NNQSOWQGSA-N |
| XLogP | 5.15 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|