C23H21ClF6N6O — CID 162605667
(5S,7R)-3-(2-chloro-6-methyl-4-pyridinyl)-7-ethyl-N-[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-azabicyclo[3.2.0]heptan-6-imine (PubChem CID 162605667) has the molecular formula C23H21ClF6N6O and a molecular weight of 546.90 g/mol. Its IUPAC name is (5S,7R)-3-(2-chloro-6-methyl-4-pyridinyl)-7-ethyl-N-[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-azabicyclo[3.2.0]heptan-6-imine.
| Compound Name | (5S,7R)-3-(2-chloro-6-methyl-4-pyridinyl)-7-ethyl-N-[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-azabicyclo[3.2.0]heptan-6-imine |
|---|---|
| PubChem CID | 162605667 |
| Molecular Formula | C23H21ClF6N6O |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | (5S,7R)-3-(2-chloro-6-methyl-4-pyridinyl)-7-ethyl-N-[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-azabicyclo[3.2.0]heptan-6-imine |
| SMILES | CC[C@H]1C(=Nc2nc3c(OCC(F)(F)F)ccc(C(F)(F)F)n3n2)[C@@H]2CN(c3cc(C)nc(Cl)c3)CC12 |
| InChI | InChI=1S/C23H21ClF6N6O/c1-3-13-14-8-35(12-6-11(2)31-18(24)7-12)9-15(14)19(13)32-21-33-20-16(37-10-22(25,26)27)4-5-17(23(28,29)30)36(20)34-21/h4-7,13-15H,3,8-10H2,1-2H3/t13-,14?,15-/m1/s1 |
| InChIKey | STTZTQKYRSXVCU-GIJJTGMTSA-N |
| XLogP | 5.91 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|