C23H26F3N7O2 — CID 162620699
2-[2-[[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azatricyclo[3.2.1.02,4]octan-8-yl]amino]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]propan-2-ol (PubChem CID 162620699) has the molecular formula C23H26F3N7O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 2-[2-[[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azatricyclo[3.2.1.02,4]octan-8-yl]amino]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]propan-2-ol.
| Compound Name | 2-[2-[[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azatricyclo[3.2.1.02,4]octan-8-yl]amino]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 162620699 |
| Molecular Formula | C23H26F3N7O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-[2-[[(1R,5S)-3-(6-methylpyrimidin-4-yl)-3-azatricyclo[3.2.1.02,4]octan-8-yl]amino]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]propan-2-ol |
| SMILES | Cc1cc(N2C3C2[C@H]2CC[C@@H]3C2Nc2nc3c(OCC(F)(F)F)ccc(C(C)(C)O)n3n2)ncn1 |
| InChI | InChI=1S/C23H26F3N7O2/c1-11-8-16(28-10-27-11)32-18-12-4-5-13(19(18)32)17(12)29-21-30-20-14(35-9-23(24,25)26)6-7-15(22(2,3)34)33(20)31-21/h6-8,10,12-13,17-19,34H,4-5,9H2,1-3H3,(H,29,31)/t12-,13+,17?,18?,19?,32? |
| InChIKey | PCTLFIMUTXIXFK-RQJWIEFHSA-N |
| XLogP | 3.07 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|