C17H19F6N5O — CID 129216653
N-[(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129216653) has the molecular formula C17H19F6N5O and a molecular weight of 423.36 g/mol. Its IUPAC name is N-[(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129216653 |
| Molecular Formula | C17H19F6N5O |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC(Oc1ccc(C(F)(F)F)n2nc(NC3[C@@H]4CC[C@H]3CNC4)nc12)C(F)(F)F |
| InChI | InChI=1S/C17H19F6N5O/c1-8(16(18,19)20)29-11-4-5-12(17(21,22)23)28-14(11)26-15(27-28)25-13-9-2-3-10(13)7-24-6-9/h4-5,8-10,13,24H,2-3,6-7H2,1H3,(H,25,27)/t8?,9-,10+,13? |
| InChIKey | CESFMYUVVZJQGV-PTNFSGFOSA-N |
| XLogP | 3.49 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |