C20H20F6N6O — CID 129232896
(1S,5R)-8-ethenyl-8-[[5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carbonitrile (PubChem CID 129232896) has the molecular formula C20H20F6N6O and a molecular weight of 474.41 g/mol. Its IUPAC name is (1S,5R)-8-ethenyl-8-[[5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carbonitrile.
| Compound Name | (1S,5R)-8-ethenyl-8-[[5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carbonitrile |
|---|---|
| PubChem CID | 129232896 |
| Molecular Formula | C20H20F6N6O |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (1S,5R)-8-ethenyl-8-[[5-(trifluoromethyl)-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carbonitrile |
| SMILES | C=CC1(Nc2nc3c(OC(C)C(F)(F)F)ccc(C(F)(F)F)n3n2)[C@@H]2CC[C@H]1CN(C#N)C2 |
| InChI | InChI=1S/C20H20F6N6O/c1-3-18(12-4-5-13(18)9-31(8-12)10-27)29-17-28-16-14(33-11(2)19(21,22)23)6-7-15(20(24,25)26)32(16)30-17/h3,6-7,11-13H,1,4-5,8-9H2,2H3,(H,29,30)/t11?,12-,13+,18? |
| InChIKey | WNUJRMCVDRQFQY-LJVRBFTLSA-N |
| XLogP | 4.24 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|