C21H25F6N5O3 — CID 146383642
tert-butyl (1S,5R)-8-[[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 146383642) has the molecular formula C21H25F6N5O3 and a molecular weight of 509.45 g/mol. Its IUPAC name is tert-butyl (1S,5R)-8-[[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl (1S,5R)-8-[[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 146383642 |
| Molecular Formula | C21H25F6N5O3 |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | tert-butyl (1S,5R)-8-[[8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H](C1)C2Nc1nc2c(OCC(F)(F)F)ccc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C21H25F6N5O3/c1-19(2,3)35-18(33)31-8-11-4-5-12(9-31)15(11)28-17-29-16-13(34-10-20(22,23)24)6-7-14(21(25,26)27)32(16)30-17/h6-7,11-12,15H,4-5,8-10H2,1-3H3,(H,28,30)/t11-,12+,15? |
| InChIKey | GAVHPNUVMNUUFP-ODOQXGPZSA-N |
| XLogP | 4.75 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |