C26H25F6N5O2 — CID 126692543
tert-butyl (1S,5S,6S)-7-[5-(trifluoromethyl)-8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonane-3-carboxylate (PubChem CID 126692543) has the molecular formula C26H25F6N5O2 and a molecular weight of 553.51 g/mol. Its IUPAC name is tert-butyl (1S,5S,6S)-7-[5-(trifluoromethyl)-8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonane-3-carboxylate.
| Compound Name | tert-butyl (1S,5S,6S)-7-[5-(trifluoromethyl)-8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonane-3-carboxylate |
|---|---|
| PubChem CID | 126692543 |
| Molecular Formula | C26H25F6N5O2 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | tert-butyl (1S,5S,6S)-7-[5-(trifluoromethyl)-8-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3,7-diazatricyclo[3.2.2.01,6]nonane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@]3(C1)[C@H]2N3c1nc2c(-c3ccc(C(F)(F)F)cc3)ccc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C26H25F6N5O2/c1-23(2,3)39-22(38)35-12-15-10-11-24(13-35)19(15)36(24)21-33-20-17(8-9-18(26(30,31)32)37(20)34-21)14-4-6-16(7-5-14)25(27,28)29/h4-9,15,19H,10-13H2,1-3H3/t15-,19-,24-,36?/m0/s1 |
| InChIKey | DBQBBNKTUPTNEY-QCJWPHPASA-N |
| XLogP | 6.02 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|